C8H8F6O2 — CID 102305750
(3R)-3-ethoxy-2,2-bis(trifluoromethyl)cyclobutan-1-one (PubChem CID 102305750) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is (3R)-3-ethoxy-2,2-bis(trifluoromethyl)cyclobutan-1-one.
| Compound Name | (3R)-3-ethoxy-2,2-bis(trifluoromethyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 102305750 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (3R)-3-ethoxy-2,2-bis(trifluoromethyl)cyclobutan-1-one |
| SMILES | CCO[C@@H]1CC(=O)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O2/c1-2-16-5-3-4(15)6(5,7(9,10)11)8(12,13)14/h5H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | OYVGSUMIKWDJGD-RXMQYKEDSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |