C44H50N2O4Si2 — CID 102307134
ethyl (E)-3,6-bis[tert-butyl(diphenyl)silyl]-2-cyano-2-(ethoxycarbonylamino)hex-3-en-5-ynoate (PubChem CID 102307134) has the molecular formula C44H50N2O4Si2 and a molecular weight of 727.07 g/mol. Its IUPAC name is ethyl (E)-3,6-bis[tert-butyl(diphenyl)silyl]-2-cyano-2-(ethoxycarbonylamino)hex-3-en-5-ynoate.
| Compound Name | ethyl (E)-3,6-bis[tert-butyl(diphenyl)silyl]-2-cyano-2-(ethoxycarbonylamino)hex-3-en-5-ynoate |
|---|---|
| PubChem CID | 102307134 |
| Molecular Formula | C44H50N2O4Si2 |
| Molecular Weight | 727.07 g/mol |
| Exact Mass | 726.33 |
| IUPAC Name | ethyl (E)-3,6-bis[tert-butyl(diphenyl)silyl]-2-cyano-2-(ethoxycarbonylamino)hex-3-en-5-ynoate |
| SMILES | CCOC(=O)NC(C#N)(C(=O)OCC)/C(=C\C#C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H50N2O4Si2/c1-9-49-40(47)44(34-45,46-41(48)50-10-2)39(52(43(6,7)8,37-28-19-13-20-29-37)38-30-21-14-22-31-38)32-23-33-51(42(3,4)5,35-24-15-11-16-25-35)36-26-17-12-18-27-36/h11-22,24-32H,9-10H2,1-8H3,(H,46,48)/b39-32+ |
| InChIKey | ZIMJLABAUKBPLS-LETMKSKHSA-N |
| XLogP | 6.69 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.07 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|