C39H67N8O13 — CID 102307689
CID 102307689 (PubChem CID 102307689) has the molecular formula C39H67N8O13 and a molecular weight of 856.01 g/mol.
| Compound Name | CID 102307689 |
|---|---|
| PubChem CID | 102307689 |
| Molecular Formula | C39H67N8O13 |
| Molecular Weight | 856.01 g/mol |
| Exact Mass | 855.48 |
| IUPAC Name | — |
| SMILES | CC(=O)N(Cc1cn(CCCCCCCCCCn2cc(COC3CC(C)(C)N([O])C(C)(C)C3)nn2)nn1)[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C39H67N8O13/c1-24(50)46(36-33(54)32(53)35(29(22-49)58-36)60-37-34(55)31(52)30(51)28(21-48)59-37)20-25-18-44(42-40-25)14-12-10-8-6-7-9-11-13-15-45-19-26(41-43-45)23-57-27-16-38(2,3)47(56)39(4,5)17-27/h18-19,27-37,48-49,51-55H,6-17,20-23H2,1-5H3/t28-,29-,30+,31+,32-,33-,34-,35-,36-,37+/m1/s1 |
| InChIKey | CMQMOPJNOFJRDO-FJCUPMBISA-N |
| XLogP | -0.45 |
| TPSA | 283.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.01 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|