C23H22N2O2 — CID 102307709
5'-methoxy-1',3',3'-trimethylspiro[benzo[g][1,4]benzoxazine-2,2'-indole] (PubChem CID 102307709) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5'-methoxy-1',3',3'-trimethylspiro[benzo[g][1,4]benzoxazine-2,2'-indole].
| Compound Name | 5'-methoxy-1',3',3'-trimethylspiro[benzo[g][1,4]benzoxazine-2,2'-indole] |
|---|---|
| PubChem CID | 102307709 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 5'-methoxy-1',3',3'-trimethylspiro[benzo[g][1,4]benzoxazine-2,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Nc3cc4ccccc4cc3O1)N2C |
| InChI | InChI=1S/C23H22N2O2/c1-22(2)18-13-17(26-4)9-10-20(18)25(3)23(22)14-24-19-11-15-7-5-6-8-16(15)12-21(19)27-23/h5-14H,1-4H3 |
| InChIKey | DPGYRMHGKIEUAW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|