C40H54N2O10S4 — CID 102307741
2-[2-[N-[2-(2-acetyloxyethylsulfanyl)ethyl]-4-[3-[4-[bis[2-(2-acetyloxyethylsulfanyl)ethyl]amino]phenyl]-2,4-dioxocyclobutyl]anilino]ethylsulfanyl]ethyl acetate (PubChem CID 102307741) has the molecular formula C40H54N2O10S4 and a molecular weight of 851.14 g/mol. Its IUPAC name is 2-[2-[N-[2-(2-acetyloxyethylsulfanyl)ethyl]-4-[3-[4-[bis[2-(2-acetyloxyethylsulfanyl)ethyl]amino]phenyl]-2,4-dioxocyclobutyl]anilino]ethylsulfanyl]ethyl acetate.
| Compound Name | 2-[2-[N-[2-(2-acetyloxyethylsulfanyl)ethyl]-4-[3-[4-[bis[2-(2-acetyloxyethylsulfanyl)ethyl]amino]phenyl]-2,4-dioxocyclobutyl]anilino]ethylsulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 102307741 |
| Molecular Formula | C40H54N2O10S4 |
| Molecular Weight | 851.14 g/mol |
| Exact Mass | 850.27 |
| IUPAC Name | 2-[2-[N-[2-(2-acetyloxyethylsulfanyl)ethyl]-4-[3-[4-[bis[2-(2-acetyloxyethylsulfanyl)ethyl]amino]phenyl]-2,4-dioxocyclobutyl]anilino]ethylsulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSCCN(CCSCCOC(C)=O)c1ccc(C2C(=O)C(c3ccc(N(CCSCCOC(C)=O)CCSCCOC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C40H54N2O10S4/c1-29(43)49-17-25-53-21-13-41(14-22-54-26-18-50-30(2)44)35-9-5-33(6-10-35)37-39(47)38(40(37)48)34-7-11-36(12-8-34)42(15-23-55-27-19-51-31(3)45)16-24-56-28-20-52-32(4)46/h5-12,37-38H,13-28H2,1-4H3 |
| InChIKey | QSZQXPMTCQFAJF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.14 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|