C36H54N2O2 — CID 102063511
2,4-bis[4-(dipentylamino)phenyl]cyclobutane-1,3-dione (PubChem CID 102063511) has the molecular formula C36H54N2O2 and a molecular weight of 546.84 g/mol. Its IUPAC name is 2,4-bis[4-(dipentylamino)phenyl]cyclobutane-1,3-dione.
| Compound Name | 2,4-bis[4-(dipentylamino)phenyl]cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 102063511 |
| Molecular Formula | C36H54N2O2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.42 |
| IUPAC Name | 2,4-bis[4-(dipentylamino)phenyl]cyclobutane-1,3-dione |
| SMILES | CCCCCN(CCCCC)c1ccc(C2C(=O)C(c3ccc(N(CCCCC)CCCCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C36H54N2O2/c1-5-9-13-25-37(26-14-10-6-2)31-21-17-29(18-22-31)33-35(39)34(36(33)40)30-19-23-32(24-20-30)38(27-15-11-7-3)28-16-12-8-4/h17-24,33-34H,5-16,25-28H2,1-4H3 |
| InChIKey | NTSOQYIZOZFTBJ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|