C15H27N — CID 102308509
2-butyl-5-[(E)-hept-1-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 102308509) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-butyl-5-[(E)-hept-1-enyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-butyl-5-[(E)-hept-1-enyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 102308509 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2-butyl-5-[(E)-hept-1-enyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCC/C=C/C1=NC(CCCC)CC1 |
| InChI | InChI=1S/C15H27N/c1-3-5-7-8-9-11-15-13-12-14(16-15)10-6-4-2/h9,11,14H,3-8,10,12-13H2,1-2H3/b11-9+ |
| InChIKey | VFEHJDGZDDXICF-PKNBQFBNSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|