C22H33NO4 — CID 102309912
diethyl (2S)-1-butyl-2-propyl-2,4-dihydroquinoline-3,3-dicarboxylate (PubChem CID 102309912) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is diethyl (2S)-1-butyl-2-propyl-2,4-dihydroquinoline-3,3-dicarboxylate.
| Compound Name | diethyl (2S)-1-butyl-2-propyl-2,4-dihydroquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102309912 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | diethyl (2S)-1-butyl-2-propyl-2,4-dihydroquinoline-3,3-dicarboxylate |
| SMILES | CCCCN1c2ccccc2CC(C(=O)OCC)(C(=O)OCC)[C@@H]1CCC |
| InChI | InChI=1S/C22H33NO4/c1-5-9-15-23-18-14-11-10-13-17(18)16-22(19(23)12-6-2,20(24)26-7-3)21(25)27-8-4/h10-11,13-14,19H,5-9,12,15-16H2,1-4H3/t19-/m0/s1 |
| InChIKey | HOLYWUULWVMOFI-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|