C15H29ClO — CID 102310953
(2R,7S)-4-chloro-7-hexyl-2-propyloxepane (PubChem CID 102310953) has the molecular formula C15H29ClO and a molecular weight of 260.85 g/mol. Its IUPAC name is (2R,7S)-4-chloro-7-hexyl-2-propyloxepane.
| Compound Name | (2R,7S)-4-chloro-7-hexyl-2-propyloxepane |
|---|---|
| PubChem CID | 102310953 |
| Molecular Formula | C15H29ClO |
| Molecular Weight | 260.85 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (2R,7S)-4-chloro-7-hexyl-2-propyloxepane |
| SMILES | CCCCCC[C@H]1CCC(Cl)C[C@@H](CCC)O1 |
| InChI | InChI=1S/C15H29ClO/c1-3-5-6-7-9-14-11-10-13(16)12-15(17-14)8-4-2/h13-15H,3-12H2,1-2H3/t13?,14-,15+/m0/s1 |
| InChIKey | IPGCEDQQGMJCIH-NOYMGPGASA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|