C9H16O2S2 — CID 102312069
(2R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfanyloxythiolan-2-ol (PubChem CID 102312069) has the molecular formula C9H16O2S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfanyloxythiolan-2-ol.
| Compound Name | (2R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfanyloxythiolan-2-ol |
|---|---|
| PubChem CID | 102312069 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (2R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfanyloxythiolan-2-ol |
| SMILES | C/C=C/SO[C@H]1S[C@@H](O)C(C)C1C |
| InChI | InChI=1S/C9H16O2S2/c1-4-5-12-11-9-7(3)6(2)8(10)13-9/h4-10H,1-3H3/b5-4+/t6?,7?,8-,9+/m1/s1 |
| InChIKey | ISJUBYSWNYCUCI-YCDDYUMYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|