C9H16O2S3 — CID 46831285
(2S,3R,4R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfinylsulfanylthiolan-2-ol (PubChem CID 46831285) has the molecular formula C9H16O2S3 and a molecular weight of 252.43 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfinylsulfanylthiolan-2-ol.
| Compound Name | (2S,3R,4R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfinylsulfanylthiolan-2-ol |
|---|---|
| PubChem CID | 46831285 |
| Molecular Formula | C9H16O2S3 |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | (2S,3R,4R,5S)-3,4-dimethyl-5-[(E)-prop-1-enyl]sulfinylsulfanylthiolan-2-ol |
| SMILES | C/C=C/S(=O)S[C@@H]1S[C@H](O)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C9H16O2S3/c1-4-5-14(11)13-9-7(3)6(2)8(10)12-9/h4-10H,1-3H3/b5-4+/t6-,7-,8+,9+,14?/m1/s1 |
| InChIKey | UJWHINCSLZQYTB-HFMCXCQQSA-N |
| XLogP | 2.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|