C14H23NO2Se — CID 102312113
N-[(2-hydroxyselanyl-5-methoxyphenyl)methyl]-N-propylpropan-1-amine (PubChem CID 102312113) has the molecular formula C14H23NO2Se and a molecular weight of 316.30 g/mol. Its IUPAC name is N-[(2-hydroxyselanyl-5-methoxyphenyl)methyl]-N-propylpropan-1-amine.
| Compound Name | N-[(2-hydroxyselanyl-5-methoxyphenyl)methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 102312113 |
| Molecular Formula | C14H23NO2Se |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[(2-hydroxyselanyl-5-methoxyphenyl)methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1cc(OC)ccc1[Se]O |
| InChI | InChI=1S/C14H23NO2Se/c1-4-8-15(9-5-2)11-12-10-13(17-3)6-7-14(12)18-16/h6-7,10,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | KURPXVXIHBLQST-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|