C14H22FNO2 — CID 102878570
2-[butyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]ethanol (PubChem CID 102878570) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-[butyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]ethanol.
| Compound Name | 2-[butyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 102878570 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[butyl-[(2-fluoro-4-methoxyphenyl)methyl]amino]ethanol |
| SMILES | CCCCN(CCO)Cc1ccc(OC)cc1F |
| InChI | InChI=1S/C14H22FNO2/c1-3-4-7-16(8-9-17)11-12-5-6-13(18-2)10-14(12)15/h5-6,10,17H,3-4,7-9,11H2,1-2H3 |
| InChIKey | VHBDSLBVNRCJDG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |