C14H24F2O — CID 144721710
1,2-difluoro-4-methoxybenzene;ethane;pentane (PubChem CID 144721710) has the molecular formula C14H24F2O and a molecular weight of 246.34 g/mol. Its IUPAC name is 1,2-difluoro-4-methoxybenzene;ethane;pentane.
| Compound Name | 1,2-difluoro-4-methoxybenzene;ethane;pentane |
|---|---|
| PubChem CID | 144721710 |
| Molecular Formula | C14H24F2O |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1,2-difluoro-4-methoxybenzene;ethane;pentane |
| SMILES | CC.CCCCC.COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H6F2O.C5H12.C2H6/c1-10-5-2-3-6(8)7(9)4-5;1-3-5-4-2;1-2/h2-4H,1H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | BHHQRCUMSXXHSA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |