C15H28O2S2 — CID 102312865
2-[4-(1,3-dithian-2-yl)-4-methylpentoxy]oxane (PubChem CID 102312865) has the molecular formula C15H28O2S2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)-4-methylpentoxy]oxane.
| Compound Name | 2-[4-(1,3-dithian-2-yl)-4-methylpentoxy]oxane |
|---|---|
| PubChem CID | 102312865 |
| Molecular Formula | C15H28O2S2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)-4-methylpentoxy]oxane |
| SMILES | CC(C)(CCCOC1CCCCO1)C1SCCCS1 |
| InChI | InChI=1S/C15H28O2S2/c1-15(2,14-18-11-6-12-19-14)8-5-10-17-13-7-3-4-9-16-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | KBGQACUPUISKAF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|