C22H21NO3S — CID 102313399
1-methyl-3-[5-(3,4,5-trimethoxyphenyl)thiophen-3-yl]indole (PubChem CID 102313399) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-methyl-3-[5-(3,4,5-trimethoxyphenyl)thiophen-3-yl]indole.
| Compound Name | 1-methyl-3-[5-(3,4,5-trimethoxyphenyl)thiophen-3-yl]indole |
|---|---|
| PubChem CID | 102313399 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-methyl-3-[5-(3,4,5-trimethoxyphenyl)thiophen-3-yl]indole |
| SMILES | COc1cc(-c2cc(-c3cn(C)c4ccccc34)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO3S/c1-23-12-17(16-7-5-6-8-18(16)23)15-11-21(27-13-15)14-9-19(24-2)22(26-4)20(10-14)25-3/h5-13H,1-4H3 |
| InChIKey | VSJJEAXEEBGTGU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |