C22H25N4O3S- — CID 102313711
4,4-bis(1-ethylbenzimidazol-2-yl)butane-1-sulfonate (PubChem CID 102313711) has the molecular formula C22H25N4O3S- and a molecular weight of 425.53 g/mol. Its IUPAC name is 4,4-bis(1-ethylbenzimidazol-2-yl)butane-1-sulfonate.
| Compound Name | 4,4-bis(1-ethylbenzimidazol-2-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 102313711 |
| Molecular Formula | C22H25N4O3S- |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4,4-bis(1-ethylbenzimidazol-2-yl)butane-1-sulfonate |
| SMILES | CCn1c(C(CCCS(=O)(=O)[O-])c2nc3ccccc3n2CC)nc2ccccc21 |
| InChI | InChI=1S/C22H26N4O3S/c1-3-25-19-13-7-5-11-17(19)23-21(25)16(10-9-15-30(27,28)29)22-24-18-12-6-8-14-20(18)26(22)4-2/h5-8,11-14,16H,3-4,9-10,15H2,1-2H3,(H,27,28,29)/p-1 |
| InChIKey | GLAZBKGALXRIMJ-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 92.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|