About [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane
[(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane (PubChem CID 89375402) has the molecular formula C16H28N2S2
and a molecular weight of 312.55 g/mol. Its IUPAC name is [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane |
| PubChem CID | 89375402 |
| Molecular Formula | C16H28N2S2 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane |
| SMILES | CCn1c(C(S(C)(C)C)S(C)(C)C)nc2ccccc21 |
| InChI | InChI=1S/C16H28N2S2/c1-8-18-14-12-10-9-11-13(14)17-15(18)16(19(2,3)4)20(5,6)7/h9-12,16H,8H2,1-7H3 |
| InChIKey | LJOLOKMJHCOYMV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane?
The IUPAC name of [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane (CID 89375402) is [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane.
What is the SMILES notation for [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane?
The canonical SMILES for [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane is CCn1c(C(S(C)(C)C)S(C)(C)C)nc2ccccc21.
What is the InChIKey of [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane?
The InChIKey is LJOLOKMJHCOYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2S2/c1-8-18-14-12-10-9-11-13(14)17-15(18)16(19(2,3)4)20(5,6)7/h9-12,16H,8H2,1-7H3.
What are the key properties of [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane?
[(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane has a molecular weight of 312.55 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-ethylbenzimidazol-2-yl)-(trimethyl-λ4-sulfanyl)methyl]-trimethyl-λ4-sulfane is sourced from PubChem (CID 89375402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).