C15H18O5 — CID 102313802
methyl (4aS,5R,6aR,7R,9aR)-7-methyl-1-methylidene-2,8-dioxo-4a,5,6,6a,7,9-hexahydro-4H-pentaleno[1,6a-c]pyran-5-carboxylate (PubChem CID 102313802) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (4aS,5R,6aR,7R,9aR)-7-methyl-1-methylidene-2,8-dioxo-4a,5,6,6a,7,9-hexahydro-4H-pentaleno[1,6a-c]pyran-5-carboxylate.
| Compound Name | methyl (4aS,5R,6aR,7R,9aR)-7-methyl-1-methylidene-2,8-dioxo-4a,5,6,6a,7,9-hexahydro-4H-pentaleno[1,6a-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 102313802 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (4aS,5R,6aR,7R,9aR)-7-methyl-1-methylidene-2,8-dioxo-4a,5,6,6a,7,9-hexahydro-4H-pentaleno[1,6a-c]pyran-5-carboxylate |
| SMILES | C=C1C(=O)OC[C@H]2[C@H](C(=O)OC)C[C@@H]3[C@@H](C)C(=O)C[C@@]132 |
| InChI | InChI=1S/C15H18O5/c1-7-10-4-9(14(18)19-3)11-6-20-13(17)8(2)15(10,11)5-12(7)16/h7,9-11H,2,4-6H2,1,3H3/t7-,9-,10-,11+,15-/m1/s1 |
| InChIKey | NPGKUMVHFMPIPE-YEFHITBRSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|