C16H20O4 — CID 102313801
methyl (4aS,5R,6aR,7S,9aS)-7,8-dimethyl-1-methylidene-2-oxo-4,4a,5,6,6a,7-hexahydropentaleno[1,6a-c]pyran-5-carboxylate (PubChem CID 102313801) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl (4aS,5R,6aR,7S,9aS)-7,8-dimethyl-1-methylidene-2-oxo-4,4a,5,6,6a,7-hexahydropentaleno[1,6a-c]pyran-5-carboxylate.
| Compound Name | methyl (4aS,5R,6aR,7S,9aS)-7,8-dimethyl-1-methylidene-2-oxo-4,4a,5,6,6a,7-hexahydropentaleno[1,6a-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 102313801 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (4aS,5R,6aR,7S,9aS)-7,8-dimethyl-1-methylidene-2-oxo-4,4a,5,6,6a,7-hexahydropentaleno[1,6a-c]pyran-5-carboxylate |
| SMILES | C=C1C(=O)OC[C@H]2[C@H](C(=O)OC)C[C@@H]3[C@H](C)C(C)=C[C@@]132 |
| InChI | InChI=1S/C16H20O4/c1-8-6-16-10(3)14(17)20-7-13(16)11(15(18)19-4)5-12(16)9(8)2/h6,9,11-13H,3,5,7H2,1-2,4H3/t9-,11-,12-,13+,16-/m1/s1 |
| InChIKey | PMCLHGQVAAMDBH-BVEFZAQCSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|