C14H22O2 — CID 135039602
ethyl (3aS,7aS)-2,2-dimethyl-1,3,3a,6,7,7a-hexahydroindene-5-carboxylate (PubChem CID 135039602) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethyl (3aS,7aS)-2,2-dimethyl-1,3,3a,6,7,7a-hexahydroindene-5-carboxylate.
| Compound Name | ethyl (3aS,7aS)-2,2-dimethyl-1,3,3a,6,7,7a-hexahydroindene-5-carboxylate |
|---|---|
| PubChem CID | 135039602 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethyl (3aS,7aS)-2,2-dimethyl-1,3,3a,6,7,7a-hexahydroindene-5-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H]2CC(C)(C)C[C@@H]2CC1 |
| InChI | InChI=1S/C14H22O2/c1-4-16-13(15)10-5-6-11-8-14(2,3)9-12(11)7-10/h7,11-12H,4-6,8-9H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | FRTCPDYPKUBYMS-RYUDHWBXSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |