C10H12O3 — CID 102313964
(1R,5R,6R)-6-prop-2-enoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 102313964) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1R,5R,6R)-6-prop-2-enoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5R,6R)-6-prop-2-enoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 102313964 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1R,5R,6R)-6-prop-2-enoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CCO[C@@H]1C[C@H]2O[C@@H]1C=CC2=O |
| InChI | InChI=1S/C10H12O3/c1-2-5-12-10-6-9-7(11)3-4-8(10)13-9/h2-4,8-10H,1,5-6H2/t8-,9-,10-/m1/s1 |
| InChIKey | VRRYJMXQDHRDPQ-OPRDCNLKSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|