C9H12O3 — CID 13031645
(1R,5S,6R)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 13031645) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (1R,5S,6R)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5S,6R)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 13031645 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (1R,5S,6R)-6-ethoxy-8-oxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CCO[C@@H]1C[C@H]2O[C@H]1C=CC2=O |
| InChI | InChI=1S/C9H12O3/c1-2-11-9-5-8-6(10)3-4-7(9)12-8/h3-4,7-9H,2,5H2,1H3/t7-,8+,9+/m0/s1 |
| InChIKey | CUWSWPRAIJBOOA-DJLDLDEBSA-N |
| XLogP | 0.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |