C18H24N2O3 — CID 102316333
(E,2R)-N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-4-phenylbut-3-enamide (PubChem CID 102316333) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (E,2R)-N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-4-phenylbut-3-enamide.
| Compound Name | (E,2R)-N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 102316333 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (E,2R)-N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-4-phenylbut-3-enamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](/C=C/c1ccccc1)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)20-16(21)14(19-15-11-12-23-17(15)22)10-9-13-7-5-4-6-8-13/h4-10,14-15,19H,11-12H2,1-3H3,(H,20,21)/b10-9+/t14-,15+/m1/s1 |
| InChIKey | KMXCIJMXPYNKEC-SPZIKGKASA-N |
| XLogP | 1.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |