C16H22N2O3 — CID 10661175
N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-2-phenylacetamide (PubChem CID 10661175) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-2-phenylacetamide.
| Compound Name | N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 10661175 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-tert-butyl-2-[[(3S)-2-oxooxolan-3-yl]amino]-2-phenylacetamide |
| SMILES | CC(C)(C)NC(=O)C(N[C@H]1CCOC1=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)18-14(19)13(11-7-5-4-6-8-11)17-12-9-10-21-15(12)20/h4-8,12-13,17H,9-10H2,1-3H3,(H,18,19)/t12-,13?/m0/s1 |
| InChIKey | DFIZPWSMPOKVNH-UEWDXFNNSA-N |
| XLogP | 1.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |