C18H24O — CID 102318467
(5R,6S)-5-methyl-5-prop-2-enyltetracyclo[7.3.1.17,11.01,6]tetradec-2-en-4-one (PubChem CID 102318467) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (5R,6S)-5-methyl-5-prop-2-enyltetracyclo[7.3.1.17,11.01,6]tetradec-2-en-4-one.
| Compound Name | (5R,6S)-5-methyl-5-prop-2-enyltetracyclo[7.3.1.17,11.01,6]tetradec-2-en-4-one |
|---|---|
| PubChem CID | 102318467 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (5R,6S)-5-methyl-5-prop-2-enyltetracyclo[7.3.1.17,11.01,6]tetradec-2-en-4-one |
| SMILES | C=CC[C@@]1(C)C(=O)C=CC23CC4CC(CC(C4)[C@@H]21)C3 |
| InChI | InChI=1S/C18H24O/c1-3-5-17(2)15(19)4-6-18-10-12-7-13(11-18)9-14(8-12)16(17)18/h3-4,6,12-14,16H,1,5,7-11H2,2H3/t12?,13?,14?,16-,17+,18?/m1/s1 |
| InChIKey | UMAJCRIWBCCBFH-CNSRUTRTSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|