C18H24O — CID 101449650
(1S,5S,6R,7R,9S,10R)-5,9-dimethyl-5-prop-2-enyltetracyclo[7.2.1.17,10.01,6]tridec-2-en-4-one (PubChem CID 101449650) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (1S,5S,6R,7R,9S,10R)-5,9-dimethyl-5-prop-2-enyltetracyclo[7.2.1.17,10.01,6]tridec-2-en-4-one.
| Compound Name | (1S,5S,6R,7R,9S,10R)-5,9-dimethyl-5-prop-2-enyltetracyclo[7.2.1.17,10.01,6]tridec-2-en-4-one |
|---|---|
| PubChem CID | 101449650 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (1S,5S,6R,7R,9S,10R)-5,9-dimethyl-5-prop-2-enyltetracyclo[7.2.1.17,10.01,6]tridec-2-en-4-one |
| SMILES | C=CC[C@]1(C)C(=O)C=C[C@]23C[C@H]4C[C@H](C[C@@]4(C)C2)[C@H]31 |
| InChI | InChI=1S/C18H24O/c1-4-6-17(3)14(19)5-7-18-10-13-8-12(15(17)18)9-16(13,2)11-18/h4-5,7,12-13,15H,1,6,8-11H2,2-3H3/t12-,13-,15+,16+,17-,18+/m1/s1 |
| InChIKey | AIMSLIUOOJGZJQ-YYUWBZLNSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|