C24H27NO7 — CID 101454486
3-[3-[(1S,5S,7S,9S,10S)-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl](113C)propanoylamino]-2,4-dihydroxy(3,5-13C2)cyclohexa-1,3,5-triene-1-carboxylic acid (PubChem CID 101454486) has the molecular formula C24H27NO7 and a molecular weight of 451.40 g/mol. Its IUPAC name is 3-[3-[(1S,5S,7S,9S,10S)-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl](113C)propanoylamino]-2,4-dihydroxy(3,5-13C2)cyclohexa-1,3,5-triene-1-carboxylic acid.
| Compound Name | 3-[3-[(1S,5S,7S,9S,10S)-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl](113C)propanoylamino]-2,4-dihydroxy(3,5-13C2)cyclohexa-1,3,5-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 101454486 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[3-[(1S,5S,7S,9S,10S)-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl](113C)propanoylamino]-2,4-dihydroxy(3,5-13C2)cyclohexa-1,3,5-triene-1-carboxylic acid |
| SMILES | C[13C]1(CC[13C](=O)N[13c]2c(O)[13cH]cc([13C](=O)O)c2O)[13C](=O)C=C[13C@]23C[13C@H]4C[C@H](O[13C@@]4(C)C2)[13CH]13 |
| InChI | InChI=1S/C24H27NO7/c1-22(7-6-17(28)25-18-14(26)4-3-13(19(18)29)21(30)31)16(27)5-8-24-10-12-9-15(20(22)24)32-23(12,2)11-24/h3-5,8,12,15,20,26,29H,6-7,9-11H2,1-2H3,(H,25,28)(H,30,31)/t12-,15+,20?,22?,23+,24+/m1/s1/i4+1,12+1,16+1,17+1,18+1,20+1,21+1,22+1,23+1,24+1 |
| InChIKey | CSOMAHTTWTVBFL-XLWGAYARSA-N |
| XLogP | 3.23 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|