C24H29NO7 — CID 101410134
2,4-dihydroxy-3-[3-[(1R,5R,6S,7R,9R,10R)-4-hydroxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-3-en-5-yl]propanoylamino]benzoic acid (PubChem CID 101410134) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2,4-dihydroxy-3-[3-[(1R,5R,6S,7R,9R,10R)-4-hydroxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-3-en-5-yl]propanoylamino]benzoic acid.
| Compound Name | 2,4-dihydroxy-3-[3-[(1R,5R,6S,7R,9R,10R)-4-hydroxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-3-en-5-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 101410134 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2,4-dihydroxy-3-[3-[(1R,5R,6S,7R,9R,10R)-4-hydroxy-5,9-dimethyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-3-en-5-yl]propanoylamino]benzoic acid |
| SMILES | C[C@@]12C[C@]34CC=C(O)[C@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@H]3[C@@H](C[C@H]1C4)O2 |
| InChI | InChI=1S/C24H29NO7/c1-22(7-6-17(28)25-18-14(26)4-3-13(19(18)29)21(30)31)16(27)5-8-24-10-12-9-15(20(22)24)32-23(12,2)11-24/h3-5,12,15,20,26-27,29H,6-11H2,1-2H3,(H,25,28)(H,30,31)/t12-,15+,20+,22-,23+,24+/m0/s1 |
| InChIKey | SWHXVYIMQRFWKE-KZKYSYIKSA-N |
| XLogP | 3.94 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|