C29H30N2O7S — CID 155565179
3-[3-[(1R,5S,6R,7S,9S,10S)-5,9-dimethyl-4-oxo-3-pyridin-2-ylsulfanyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 155565179) has the molecular formula C29H30N2O7S and a molecular weight of 550.63 g/mol. Its IUPAC name is 3-[3-[(1R,5S,6R,7S,9S,10S)-5,9-dimethyl-4-oxo-3-pyridin-2-ylsulfanyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-5,9-dimethyl-4-oxo-3-pyridin-2-ylsulfanyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 155565179 |
| Molecular Formula | C29H30N2O7S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-5,9-dimethyl-4-oxo-3-pyridin-2-ylsulfanyl-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | C[C@]12C[C@@]34C=C(Sc5ccccn5)C(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2 |
| InChI | InChI=1S/C29H30N2O7S/c1-27(9-8-20(33)31-22-17(32)7-6-16(23(22)34)26(36)37)24-18-11-15-12-29(24,14-28(15,2)38-18)13-19(25(27)35)39-21-5-3-4-10-30-21/h3-7,10,13,15,18,24,32,34H,8-9,11-12,14H2,1-2H3,(H,31,33)(H,36,37)/t15-,18+,24+,27+,28+,29-/m1/s1 |
| InChIKey | PQGOELGGOSLXKN-MWHRVTMQSA-N |
| XLogP | 4.75 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|