C30H37NO6S — CID 162672038
3-[3-[(1S,5S,6R,8R)-3-cyclohexylsulfanyl-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 162672038) has the molecular formula C30H37NO6S and a molecular weight of 539.69 g/mol. Its IUPAC name is 3-[3-[(1S,5S,6R,8R)-3-cyclohexylsulfanyl-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1S,5S,6R,8R)-3-cyclohexylsulfanyl-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 162672038 |
| Molecular Formula | C30H37NO6S |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 3-[3-[(1S,5S,6R,8R)-3-cyclohexylsulfanyl-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | C=C1C[C@]23C=C(SC4CCCCC4)C(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)O)c4O)[C@@H]2C[C@H]1CC3 |
| InChI | InChI=1S/C30H37NO6S/c1-17-15-30-13-10-18(17)14-23(30)29(2,27(35)22(16-30)38-19-6-4-3-5-7-19)12-11-24(33)31-25-21(32)9-8-20(26(25)34)28(36)37/h8-9,16,18-19,23,32,34H,1,3-7,10-15H2,2H3,(H,31,33)(H,36,37)/t18-,23+,29+,30-/m1/s1 |
| InChIKey | RFRXEYDNDLMBII-CQHLWJJXSA-N |
| XLogP | 6.42 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|