C25H31NO5 — CID 58130688
N-(2,6-dihydroxy-3-methylphenyl)-3-[(5S)-2,5,9-trimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanamide (PubChem CID 58130688) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(2,6-dihydroxy-3-methylphenyl)-3-[(5S)-2,5,9-trimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanamide.
| Compound Name | N-(2,6-dihydroxy-3-methylphenyl)-3-[(5S)-2,5,9-trimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanamide |
|---|---|
| PubChem CID | 58130688 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-(2,6-dihydroxy-3-methylphenyl)-3-[(5S)-2,5,9-trimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanamide |
| SMILES | CC1=CC(=O)C(C)(CCC(=O)Nc2c(O)ccc(C)c2O)C2C3CC4CC12CC4(C)O3 |
| InChI | InChI=1S/C25H31NO5/c1-13-5-6-16(27)20(21(13)30)26-19(29)7-8-23(3)18(28)9-14(2)25-11-15-10-17(22(23)25)31-24(15,4)12-25/h5-6,9,15,17,22,27,30H,7-8,10-12H2,1-4H3,(H,26,29) |
| InChIKey | GOXWQQBRJVJKDW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|