C6H6O2S2 — CID 102321523
1,3-bis(hydroxysulfanyl)benzene (PubChem CID 102321523) has the molecular formula C6H6O2S2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,3-bis(hydroxysulfanyl)benzene.
| Compound Name | 1,3-bis(hydroxysulfanyl)benzene |
|---|---|
| PubChem CID | 102321523 |
| Molecular Formula | C6H6O2S2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 1,3-bis(hydroxysulfanyl)benzene |
| SMILES | OSc1cccc(SO)c1 |
| InChI | InChI=1S/C6H6O2S2/c7-9-5-2-1-3-6(4-5)10-8/h1-4,7-8H |
| InChIKey | PTWDEKUVTYYBHV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|