About bis(3-methylsulfanylphenol);zirconium
bis(3-methylsulfanylphenol);zirconium (PubChem CID 174409712) has the molecular formula C14H16O2S2Zr
and a molecular weight of 371.64 g/mol. Its IUPAC name is bis(3-methylsulfanylphenol);zirconium.
Molecular Properties
| Compound Name | bis(3-methylsulfanylphenol);zirconium |
| PubChem CID | 174409712 |
| Molecular Formula | C14H16O2S2Zr |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | bis(3-methylsulfanylphenol);zirconium |
| SMILES | CSc1cccc(O)c1.CSc1cccc(O)c1.[Zr] |
| InChI | InChI=1S/2C7H8OS.Zr/c2*1-9-7-4-2-3-6(8)5-7;/h2*2-5,8H,1H3; |
| InChIKey | WOHVHWBPMWJNFQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(3-methylsulfanylphenol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylsulfanylphenol);zirconium?
The IUPAC name of bis(3-methylsulfanylphenol);zirconium (CID 174409712) is bis(3-methylsulfanylphenol);zirconium.
What is the SMILES notation for bis(3-methylsulfanylphenol);zirconium?
The canonical SMILES for bis(3-methylsulfanylphenol);zirconium is CSc1cccc(O)c1.CSc1cccc(O)c1.[Zr].
What is the InChIKey of bis(3-methylsulfanylphenol);zirconium?
The InChIKey is WOHVHWBPMWJNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8OS.Zr/c2*1-9-7-4-2-3-6(8)5-7;/h2*2-5,8H,1H3;.
What are the key properties of bis(3-methylsulfanylphenol);zirconium?
bis(3-methylsulfanylphenol);zirconium has a molecular weight of 371.64 g/mol, XLogP of 4.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylsulfanylphenol);zirconium is sourced from PubChem (CID 174409712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).