C29H29N3O2 — CID 102322507
2-(4-methyl-2-pyridinyl)-4-[(E)-2-[4-(5-pyridin-4-yloxypentoxy)phenyl]ethenyl]pyridine (PubChem CID 102322507) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-(4-methyl-2-pyridinyl)-4-[(E)-2-[4-(5-pyridin-4-yloxypentoxy)phenyl]ethenyl]pyridine.
| Compound Name | 2-(4-methyl-2-pyridinyl)-4-[(E)-2-[4-(5-pyridin-4-yloxypentoxy)phenyl]ethenyl]pyridine |
|---|---|
| PubChem CID | 102322507 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-(4-methyl-2-pyridinyl)-4-[(E)-2-[4-(5-pyridin-4-yloxypentoxy)phenyl]ethenyl]pyridine |
| SMILES | Cc1ccnc(-c2cc(/C=C/c3ccc(OCCCCCOc4ccncc4)cc3)ccn2)c1 |
| InChI | InChI=1S/C29H29N3O2/c1-23-11-17-31-28(21-23)29-22-25(12-18-32-29)6-5-24-7-9-26(10-8-24)33-19-3-2-4-20-34-27-13-15-30-16-14-27/h5-18,21-22H,2-4,19-20H2,1H3/b6-5+ |
| InChIKey | LHUDVPQRVWUFDN-AATRIKPKSA-N |
| XLogP | 6.65 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|