C24H28N2O — CID 69499097
4-[2-(4-hexoxyphenyl)ethenyl]pyridine;pyridine (PubChem CID 69499097) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[2-(4-hexoxyphenyl)ethenyl]pyridine;pyridine.
| Compound Name | 4-[2-(4-hexoxyphenyl)ethenyl]pyridine;pyridine |
|---|---|
| PubChem CID | 69499097 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-[2-(4-hexoxyphenyl)ethenyl]pyridine;pyridine |
| SMILES | CCCCCCOc1ccc(C=Cc2ccncc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C19H23NO.C5H5N/c1-2-3-4-5-16-21-19-10-8-17(9-11-19)6-7-18-12-14-20-15-13-18;1-2-4-6-5-3-1/h6-15H,2-5,16H2,1H3;1-5H |
| InChIKey | MHLMWXIWGKGEGI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|