C10H15NO4 — CID 102322914
ethyl (4S,5S)-4-methyl-5-nitrocyclohexene-1-carboxylate (PubChem CID 102322914) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is ethyl (4S,5S)-4-methyl-5-nitrocyclohexene-1-carboxylate.
| Compound Name | ethyl (4S,5S)-4-methyl-5-nitrocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102322914 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | ethyl (4S,5S)-4-methyl-5-nitrocyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H](C)[C@@H]([N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H15NO4/c1-3-15-10(12)8-5-4-7(2)9(6-8)11(13)14/h5,7,9H,3-4,6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | UJVNPQRBQCLOSO-CBAPKCEASA-N |
| XLogP | 1.55 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|