C12H19NO2 — CID 102322919
ethyl (3aR,7R,7aR)-7-amino-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate (PubChem CID 102322919) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl (3aR,7R,7aR)-7-amino-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate.
| Compound Name | ethyl (3aR,7R,7aR)-7-amino-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 102322919 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl (3aR,7R,7aR)-7-amino-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H]2CCC[C@H]2[C@H](N)C1 |
| InChI | InChI=1S/C12H19NO2/c1-2-15-12(14)9-6-8-4-3-5-10(8)11(13)7-9/h6,8,10-11H,2-5,7,13H2,1H3/t8-,10-,11-/m1/s1 |
| InChIKey | MKOAUCJDPYCLIV-FBIMIBRVSA-N |
| XLogP | 1.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |