C19H21N3O8 — CID 102324539
1-[(1R,5R,7R,8S)-8-hydroxy-5-(hydroxymethyl)-3-(2-phenoxyacetyl)-2,6-dioxa-3-azabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 102324539) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is 1-[(1R,5R,7R,8S)-8-hydroxy-5-(hydroxymethyl)-3-(2-phenoxyacetyl)-2,6-dioxa-3-azabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,5R,7R,8S)-8-hydroxy-5-(hydroxymethyl)-3-(2-phenoxyacetyl)-2,6-dioxa-3-azabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102324539 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[(1R,5R,7R,8S)-8-hydroxy-5-(hydroxymethyl)-3-(2-phenoxyacetyl)-2,6-dioxa-3-azabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CO)CN(C(=O)COc4ccccc4)O[C@@H]2[C@@H]3O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H21N3O8/c1-11-7-21(18(27)20-16(11)26)17-14-15(25)19(10-23,29-17)9-22(30-14)13(24)8-28-12-5-3-2-4-6-12/h2-7,14-15,17,23,25H,8-10H2,1H3,(H,20,26,27)/t14-,15+,17-,19-/m1/s1 |
| InChIKey | LODWNBFELIMHSV-LORHWOILSA-N |
| XLogP | -1.31 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |