C18H23NO7 — CID 102324837
dimethyl (2R,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 102324837) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is dimethyl (2R,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2R,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102324837 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | dimethyl (2R,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C[C@H]1[C@@H](c2ccccc2OC)CN(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H23NO7/c1-23-14-8-6-5-7-11(14)13-10-19(18(22)26-4)16(17(21)25-3)12(13)9-15(20)24-2/h5-8,12-13,16H,9-10H2,1-4H3/t12-,13+,16+/m0/s1 |
| InChIKey | MVLVBIZGMDOXMZ-WOSRLPQWSA-N |
| XLogP | 1.58 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|