C21H26N2O7 — CID 68805312
1-O-tert-butyl 2-O-methyl (2S,3R,4S)-4-(4-cyanophenoxy)-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 68805312) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-4-(4-cyanophenoxy)-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-4-(4-cyanophenoxy)-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 68805312 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-4-(4-cyanophenoxy)-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C[C@H]1Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H26N2O7/c1-21(2,3)30-20(26)23-12-16(29-14-8-6-13(11-22)7-9-14)15(10-17(24)27-4)18(23)19(25)28-5/h6-9,15-16,18H,10,12H2,1-5H3/t15-,16+,18-/m0/s1 |
| InChIKey | SZGLVBZPNCXLMW-JZXOWHBKSA-N |
| XLogP | 2.28 |
| TPSA | 115.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|