C20H26N2O9 — CID 58003767
1-O-tert-butyl 2-O-methyl (2S,3R,4S)-3-(2-methoxy-2-oxoethyl)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 58003767) has the molecular formula C20H26N2O9 and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-3-(2-methoxy-2-oxoethyl)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-3-(2-methoxy-2-oxoethyl)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58003767 |
| Molecular Formula | C20H26N2O9 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4S)-3-(2-methoxy-2-oxoethyl)-4-(4-nitrophenoxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C[C@H]1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H26N2O9/c1-20(2,3)31-19(25)21-11-15(30-13-8-6-12(7-9-13)22(26)27)14(10-16(23)28-4)17(21)18(24)29-5/h6-9,14-15,17H,10-11H2,1-5H3/t14-,15+,17-/m0/s1 |
| InChIKey | SBSUYFXUCMEENX-UXLLHSPISA-N |
| XLogP | 2.31 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|