C23H30N2O7 — CID 158093219
methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[2-(4-nitrophenoxy)-2-oxoethyl]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 158093219) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[2-(4-nitrophenoxy)-2-oxoethyl]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[2-(4-nitrophenoxy)-2-oxoethyl]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 158093219 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[2-(4-nitrophenoxy)-2-oxoethyl]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C23H30N2O7/c1-22(2,3)15(11-17(26)32-14-9-7-13(8-10-14)25(29)30)20(27)24-12-16-18(23(16,4)5)19(24)21(28)31-6/h7-10,15-16,18-19H,11-12H2,1-6H3/t15-,16+,18+,19+/m1/s1 |
| InChIKey | GFHOWHMDHUMFEC-NEPXVJNWSA-N |
| XLogP | 3.21 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|