C23H31NO6S2Si — CID 102325260
[(3R,4R)-4-acetyloxy-1-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-2,5-dioxopyrrolidin-3-yl] acetate (PubChem CID 102325260) has the molecular formula C23H31NO6S2Si and a molecular weight of 509.72 g/mol. Its IUPAC name is [(3R,4R)-4-acetyloxy-1-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-2,5-dioxopyrrolidin-3-yl] acetate.
| Compound Name | [(3R,4R)-4-acetyloxy-1-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-2,5-dioxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 102325260 |
| Molecular Formula | C23H31NO6S2Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [(3R,4R)-4-acetyloxy-1-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-2,5-dioxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)N(CCCC2([Si](C)(C)c3ccccc3)SCCCS2)C(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H31NO6S2Si/c1-16(25)29-19-20(30-17(2)26)22(28)24(21(19)27)13-8-12-23(31-14-9-15-32-23)33(3,4)18-10-6-5-7-11-18/h5-7,10-11,19-20H,8-9,12-15H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | BJFJRXMDRVSNPR-WOJBJXKFSA-N |
| XLogP | 2.72 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|