C30H37NO7S2Si — CID 23624448
[(3R,4R)-2,4-diacetyloxy-1-[3-[2-[methyl(diphenyl)silyl]-1,3-dithian-2-yl]propyl]-5-oxopyrrolidin-3-yl] acetate (PubChem CID 23624448) has the molecular formula C30H37NO7S2Si and a molecular weight of 615.85 g/mol. Its IUPAC name is [(3R,4R)-2,4-diacetyloxy-1-[3-[2-[methyl(diphenyl)silyl]-1,3-dithian-2-yl]propyl]-5-oxopyrrolidin-3-yl] acetate.
| Compound Name | [(3R,4R)-2,4-diacetyloxy-1-[3-[2-[methyl(diphenyl)silyl]-1,3-dithian-2-yl]propyl]-5-oxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 23624448 |
| Molecular Formula | C30H37NO7S2Si |
| Molecular Weight | 615.85 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | [(3R,4R)-2,4-diacetyloxy-1-[3-[2-[methyl(diphenyl)silyl]-1,3-dithian-2-yl]propyl]-5-oxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)N1CCCC1([Si](C)(c2ccccc2)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C30H37NO7S2Si/c1-21(32)36-26-27(37-22(2)33)29(38-23(3)34)31(28(26)35)18-11-17-30(39-19-12-20-40-30)41(4,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-10,13-16,26-27,29H,11-12,17-20H2,1-4H3/t26-,27-,29?/m1/s1 |
| InChIKey | DEDLTXTUOZHJFM-PNDVLSOFSA-N |
| XLogP | 3.36 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|