C22H33NO4S2Si — CID 102325266
(3aR,6R,6aS)-5-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-6-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one (PubChem CID 102325266) has the molecular formula C22H33NO4S2Si and a molecular weight of 467.73 g/mol. Its IUPAC name is (3aR,6R,6aS)-5-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-6-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one.
| Compound Name | (3aR,6R,6aS)-5-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-6-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one |
|---|---|
| PubChem CID | 102325266 |
| Molecular Formula | C22H33NO4S2Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (3aR,6R,6aS)-5-[3-[2-[dimethyl(phenyl)silyl]-1,3-dithian-2-yl]propyl]-6-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)N(CCCC3([Si](C)(C)c4ccccc4)SCCCS3)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C22H33NO4S2Si/c1-21(2)26-17-18(27-21)20(25)23(19(17)24)13-8-12-22(28-14-9-15-29-22)30(3,4)16-10-6-5-7-11-16/h5-7,10-11,17-19,24H,8-9,12-15H2,1-4H3/t17-,18+,19+/m0/s1 |
| InChIKey | DVTPQKCCHPJOBJ-IPMKNSEASA-N |
| XLogP | 3.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|