C10H14O3S2 — CID 102325654
3,3-dimethyl-1-thiophen-3-ylsulfonylbutan-2-one (PubChem CID 102325654) has the molecular formula C10H14O3S2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-thiophen-3-ylsulfonylbutan-2-one.
| Compound Name | 3,3-dimethyl-1-thiophen-3-ylsulfonylbutan-2-one |
|---|---|
| PubChem CID | 102325654 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3,3-dimethyl-1-thiophen-3-ylsulfonylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C10H14O3S2/c1-10(2,3)9(11)7-15(12,13)8-4-5-14-6-8/h4-6H,7H2,1-3H3 |
| InChIKey | QNOXYJNLZOVVRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |