C10H20N2O2S2 — CID 157152983
N,N-diethylethanamine;thiophene-3-sulfonamide (PubChem CID 157152983) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N,N-diethylethanamine;thiophene-3-sulfonamide.
| Compound Name | N,N-diethylethanamine;thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 157152983 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N,N-diethylethanamine;thiophene-3-sulfonamide |
| SMILES | CCN(CC)CC.NS(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C6H15N.C4H5NO2S2/c1-4-7(5-2)6-3;5-9(6,7)4-1-2-8-3-4/h4-6H2,1-3H3;1-3H,(H2,5,6,7) |
| InChIKey | ALLWXOKDZRWSRX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |