About N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline
N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline (PubChem CID 102326159) has the molecular formula C17H20ClNO
and a molecular weight of 289.81 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline |
| PubChem CID | 102326159 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline |
| SMILES | COc1c(C)cc(N[C@H](C)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C17H20ClNO/c1-11-9-16(10-12(2)17(11)20-4)19-13(3)14-5-7-15(18)8-6-14/h5-10,13,19H,1-4H3/t13-/m1/s1 |
| InChIKey | KZXQPHDZHIXHIL-CYBMUJFWSA-N |
| XLogP | 5.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline?
The IUPAC name of N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline (CID 102326159) is N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline.
What is the SMILES notation for N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline?
The canonical SMILES for N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline is COc1c(C)cc(N[C@H](C)c2ccc(Cl)cc2)cc1C.
What is the InChIKey of N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline?
The InChIKey is KZXQPHDZHIXHIL-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H20ClNO/c1-11-9-16(10-12(2)17(11)20-4)19-13(3)14-5-7-15(18)8-6-14/h5-10,13,19H,1-4H3/t13-/m1/s1.
What are the key properties of N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline?
N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline has a molecular weight of 289.81 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(4-chlorophenyl)ethyl]-4-methoxy-3,5-dimethylaniline is sourced from PubChem (CID 102326159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).