C16H17Br2N — CID 107572230
4-bromo-N-[1-(4-bromophenyl)ethyl]-3,5-dimethylaniline (PubChem CID 107572230) has the molecular formula C16H17Br2N and a molecular weight of 383.13 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-bromophenyl)ethyl]-3,5-dimethylaniline.
| Compound Name | 4-bromo-N-[1-(4-bromophenyl)ethyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 107572230 |
| Molecular Formula | C16H17Br2N |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 4-bromo-N-[1-(4-bromophenyl)ethyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(NC(C)c2ccc(Br)cc2)cc(C)c1Br |
| InChI | InChI=1S/C16H17Br2N/c1-10-8-15(9-11(2)16(10)18)19-12(3)13-4-6-14(17)7-5-13/h4-9,12,19H,1-3H3 |
| InChIKey | MBMDPRIGUJRQJL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |